khevin555
khevin555 khevin555
  • 13-04-2020
  • Health
contestada

1=1
2=4
3=9
4-6
5=5
6=?
what is it..?

Respuesta :

nevfrett
nevfrett nevfrett
  • 13-04-2020
Yes the answer is 4 hope this helps
Answer Link

Otras preguntas

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2
For this assignment, you will write a narrative that completes ALL of the following requirements : Is at least two pages. (25 pts) Includes at least one charact
Explain in your own words what the CSI effect is. Describe how it changes the perception of potential jurors. Would the CSI effect affect you as a juror? Why or
A rectangular prism has a length of 19in, a height of 10in, and a width of 6in. What is its volume, in cubic in? PLS HELP ME!!!
sum of integers from 15 to 25 inclusive
f5 The ratio of boys to girls in a class is 2:3. There are 30 students in the class. How many students are boys? ​
perimeter of a square is 256cm. what is its area​
when writing the theme of a novel, do you need to write an explanation or something? like for example is this okay: what is the theme of the novel? the theme o
three-part question that follows, provide your answer to each part in the given workspace. Identify each part with a coordinating response. Be s Use the figure
What is the legislation at issue?