saritasofiaccalde saritasofiaccalde

13-05-2020
Mathematics

contestada

The scale of a map is 2 inches = 7 feet. if the map distance 11 inches what is the actual distance in feet?

Respuesta :

nevaehrain38 nevaehrain38

13-05-2020

Answer:38.5

Step-by-step explanation:

7÷2 = 3.5

11*3.5 = 38.5

Answer Link

Otras preguntas

Which of the following causes the greatest degree of light refraction in the eye?

Which of the following represents the top view of the figure?

Many ocean-dwelling animals can use sound waves to communicate with other animals and locate food and obstacles over longer distances than can land-dwelling ani

The cost of a product has been increasing each year. The graph shows data about the product's cost over time. Which is a reasonable prediction for the cost of t

Show that cos(A+45)=cos45(cosA-sinA)

Write the opposite of – 1/2 explain.

Which one of the following statements is accurate? A. Electron microscopes focus beams of light using magnetic fields. B. Compound light microscopes util

The goat has body cells containing 30 chromosomes. Assume that one germ cell of a male goat undergoes meiosis and produces four sperm cells. Which of the follow

Which of these is most likely to help someone avoid alcohol? A. Advertisements from alcohol companies B. A public service announcement C. Friends who

Solutes lower the freezing point of water by: a. Stopping water molecules from moving b.forming crystals c.making it harder for water to form crystals d. Makin