lilydelatrinidad19 lilydelatrinidad19

13-10-2020
Mathematics

contestada

Need help ASAP have 30 minutes

Need help ASAP have 30 minutes class=

Respuesta :

kendallvincent46 kendallvincent46

13-10-2020

7.25$ for one box of paper
Explanation: divide 14.50 by 2

Answer Link

amyricheson07 amyricheson07

13-10-2020

Answer:

1 box of paper will cost $7.25.

Step-by-step explanation:

14.50 divided by 2 is 7.25, therefore one box of paper will be 7.25

Answer Link

Otras preguntas

how to balance this equation NH4OH+H3PO4=(NH4)3PO4+H2O with explainatio please

The students want to increase the volume of gas the pond weed makes in 5 minutes. The students use a drinking straw to bubble some of their breath into the wate

Why is the MO structure of NO+ different than that of N2? (the structure, not the number of electrons)

Why is it possible for a conventional mortgage payment to fluctuate over the life of the mortgage?.

Stockholders of a corporation directly elect the president of the corporation. all of the employees of the corporation. the board of directors. the treasurer of

Assume that P(E) = 0.471 and P(F) = 0.595. If E and F are independent, find P(E and F)

A projectile is launched with a velocity of 13.2 m/s at an angle of 37.0° above the horizontal. How high above the point from which it was fired will the projec

Find the perimeter of the rectangle.

-0.2 2 is repeating as a fraction

ASSIGNMENT FORM 2 1. Evaluate the following without using mathematical tables 0.36 x 6(142 +58) 21.44 - 10.64