emileelewis17 emileelewis17

11-12-2020
Mathematics

contestada

Andrew is a realtor who makes 11% commissions. if he recently sold a house for $120,000 how much would he make in commissions

Respuesta :

Theonechris Theonechris

11-12-2020

Answer:

the answer would be 133200 dollars

Answer Link

Otras preguntas

(x+5)²=9 Difference of 2 squares quadratic equation solve (please show full working)

Which example best shows how speeches can be interactive? O A. Rae speaks louder when she realizes the audience in the back can't hear her. B. Deven goes to the

A bus can seat at most 48 students. Let s= number of students

On Sunday sandy pays for 2 plane tickets, 7 nights in a hotel and 2 theme park tickets

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

A tower is located 325 ft from a building. From a window in the building, an observer notes that the angle of elevation to the top of the tower is 40 degrees an

toby‘s next move and the game was clever and quit just like his reputation

Why did so many Aztecs die from European diseases? ILL GIVE BRAINLYEST TO RIGHT ANSWERA. They were not civilized enough to develop medicines to stop the disease

Question 1 of 5 Select the correct answer. Solve the following. √50 × 3√2 = ? 6√13 O 10 30 O 0 6 Submit. what is the answer

ANSWER ASAP!!! QUESTION 20!!!!!!