alphaomegamcallen alphaomegamcallen
  • 11-12-2020
  • Mathematics
contestada

8 5/12 divided by 1 3/4

Respuesta :

endrovergonza1
endrovergonza1 endrovergonza1
  • 11-12-2020

^fractions lesson^

8 5/12 : 1 3/4

step 1:

(8 × 12 + 5)/12

=101/12

step 2:

(1 × 4 + 3)/4

=7/4

ok, enter:

101/12 : 7/4

=101/12 × 4/7

=404/84

=4 68/84

=4 17/21

Answer Link

Otras preguntas

Driving a motor vehicle often requires __________ reaction time. don't let all the other posts get it wrong for you its COMPLEX!!! NOT STANDARD. seen way to man
Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please
In pqr the measure of r=90 qp=65 rq=33 and pr=56 what ratio represents the sine of q
Which two dog breeds originally come from a canadian province?.
an example of an incentive program a government may use to simulate the economy is ​
PLEASE HELP IMMEDIATELY 1. Based on the context, what does "Jovian" refer to? 2. Before Roemer calculated the speed of light, how fast was the speed of light th
Algebra 2 pls help!!! why do you only reflect one “side” of a parabola when defining its inverse?
algebra 2 pls help ill give brainliest
is of the bay a prepositional phrase
What is equivalent to 3(5-2i)?