marii777 marii777
  • 15-01-2021
  • Mathematics
contestada

Simplify the expression:
3g - g + 69

Respuesta :

NgShiYin
NgShiYin NgShiYin
  • 15-01-2021

Answer:

2g + 69

Step-by-step explanation:

Since 3g and g has the same variable: g, you can directly evaluate their co-efficients: 3 and 1.

3g - g = (3-1)g

          = 2g

Answer Link
ChloeRD223
ChloeRD223 ChloeRD223
  • 15-01-2021

Answer:

2g+69

Step-by-step explanation:

The answer is just 3g being subtracted by g, or 1g, which will give you 2g. Then, you can't do anything with the + 69 because there is no other numbers to go with it to change, so it stays the same.

Hope it helps!

Answer Link

Otras preguntas

Answer urgently needed pls
Which phrase is the best definition of a symbol? ( A ) a literary device that involves comparing two unlike things ( B ) an object or idea that is used to repr
What role did rivers play in the rise of the shang dynasty and the other three ancient civilization
ASAP PLEASE! PART TO PART RATIOS!2) Line segment BA¯¯¯¯¯¯¯¯ has endpoints B(−6,1) and A(4,6).What are the coordinates of the point that partitions BA¯¯¯¯¯¯¯¯acc
introductions of debate​
What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2
can someone help me please
8 km = 5 miles 55 miles = ? km
What are the 4 types of shares?​
15) The diagram below represents the sequence of events (steps 1 through 10) resulting in the production of a D' meson and a D* meson. An electron and a positro