455526 455526
  • 12-02-2021
  • History
contestada

Please can someone help me

Please can someone help me class=

Respuesta :

Kylapg207 Kylapg207
  • 12-02-2021

Answer:

what do you need help with??

Explanation:

Answer Link
PlXlES
PlXlES PlXlES
  • 12-02-2021

Answer:

search each answer up & write it in your own words

research on Britannica if you need more help

Answer Link

Otras preguntas

how do conditions in the united states change when the jet stream moves north?
Stuck on this question.
In which sentence does the underlined word have the most positive connotation? The candidate's speech interested the crowd. The candidate's speech affecte
Queen Zubaida wishes to choose a Satrap and a Vizier from among her $12$ courtiers. How many different ways can she assign the two roles, assuming the same pers
Name native tribes and their relationship with other regions.
1. The main function of the digestive is to A. Break down large molecules into small molecules and absorb nutrients B. Excrete oxygen and carbon dioxide C. Syn
I'm pretty sure I asked this one already, but I need help.
balance this equation Pb(NO3)2+Na2(CrO4)=Pb(CtO4)+Na(NO3)
How did President Jackson respond to the Supreme Court's ruling in Worcester v. Georgia
How does the activation energy differ between reactions A and B, which are both enzyme-catalyzed reactions? Choices: A.Reaction A has a lower activation energy