pigmonster2008 pigmonster2008

11-03-2021
Law

contestada

Can I sue someone for biting a KitKat like this? If so ill be $100 million dollars richer in a few months.

Can I sue someone for biting a KitKat like this If so ill be 100 million dollars richer in a few months class=

Respuesta :

ScrubbyB ScrubbyB

11-03-2021

Answer:

yes

Explanation:

Answer Link

Otras preguntas

Please don’t lie to me and tell the right answer and if you do get it correct I will give you a shout out thanks

what is the difference between squaring and taking the square root ?

Eric pours some iced tea into a glass. When he puts the iced tea in the glass, the energy of the glass decreases. What must be true of the energy of the iced te

Identify the purpose of each topic as either to inform or to persuade. a nutritional label on a juice carton the need for daylight savings time ten reasons to e

Ch3chclch(ch3)ch2ch2ch2ch2br name the molecule iupac rules please

A 210-N mass is suspended from a horizontal beam by two cables that make angles of 29 degrees and 53 degrees with the beam. Find, using vectors, the tension in

M(-5, 2) and N(5, 2) are the endpoints of the segment MN on the coordinate plane. What is the length of ? A. 5 units B. 9 units C. 10 units D. 12 units Th

What's manifestation

How do the descriptions of the weather affect our impression of this setting and how it might feel for the characters? What images stand out the most? the air w

ها ( در محمود) و Which expression is equivalent to O x²7 (3√7)