havynn61 havynn61
  • 13-09-2021
  • Mathematics
contestada

brainiest to the correct answer thanks

brainiest to the correct answer thanks class=

Respuesta :

BlueSock
BlueSock BlueSock
  • 13-09-2021
I think the answer is A DFE
Answer Link

Otras preguntas

Evaluate the function at the given value F(n)= 3n^3 + 8n^2 + 7n + 1 at n= -2
Students learning English for the" first time should not be able to use translations in their native language".A. TrueB. False
Complete the following sentence. is a specific thing, person, or event that demonstrates a point. A topic sentence An example A statistic A fact
Analyze the foot of the following phrase. “peaceful lake” number of feet:__ type of feet:______
Which evidence supports the big bang theory? Select three options. 1.Many galaxies exist. 2.Planetesimals form in debris disks. 3.Most galaxies are moving away
If a= -9 and b= -4, what is the value of a + b?
Scientist are not finding a diverse population of organism on the coral reefs in the bahamas. True or False
Geoff gets paid $33,500 per year. How much is each one of his weekly paychecks? *
Balance the reaction of c6h12o6(s)+o2(g)=co2(g)+h2o(l)
Which expression is equivalent to 11 - (-3 5/8) ? Choose 1: A. 3 5/8 + (-11) B. 11 + (-3 5/8) C. -3 5/8 - 11 D. 11 + 3 5/8