CharissaFloyd22 CharissaFloyd22

15-09-2021
Mathematics

contestada

Unk
2 Describe Write a word or phrase beginning
with each letter of the word CHANGE that
describes changes you have observed in
everyday objects.

Respuesta :

miakuwii miakuwii

15-09-2021

Answer:

food

Step-by-step explanation:

food

Answer Link

4806015563 4806015563

15-09-2021

Answer:If it describes change mine would be couch,hallway,adventure,nipples,games,epic foods.

Step-by-step explanation:

Answer Link

Otras preguntas

Which of the following scenarios would most likely suggest that the person may be engaging in substance abuse? (Select all that apply.) a. Because of a family

Using the addition or subtraction formulas for sine or cosine... sin(a)sin(b)=(sin(a+b)+sin(a-b))/2

What is the difference between soluble and insoluble

Express the sum in simplest form 1/x + 1/y PLEASE!!!!!! I’m trying to graduate

Study the stem-and-leaf plot. How many cars get 8 miles per gallon?

Please help! Time sensitive, will mark branliest if all correct. Thank you!

ill give brainliest pls help!!! What is the best format for presenting information? Why is it important to think about the medium you use for presenting informa

When replying to your classmates, discuss how you think the responsibilities of a medical transcriptionist could affect patient care.When replying to your class

The circumference of a base of a cylinder is 33.3 inches and the height of the cylinder is 7.7 inches. What is the surface area of the cylinder

Which change will occur in the bow after the string is released? A. Nuclear potential energy B. Elastic potential energy C. Chemical potential energy D. Gra