Seudónimo Seudónimo
  • 13-02-2017
  • Health
contestada

what dose neutered mean

Respuesta :

dashabo123
dashabo123 dashabo123
  • 13-02-2017
castrate or spray (a domestic animal)
Answer Link
mforutne245
mforutne245 mforutne245
  • 13-02-2017
For a male dog to get their genitals removed.
Answer Link

Otras preguntas

Interactions ons Describing Electric Forces 2. Using simple language, explain how your demonstration shows the effect of distance on electric forces. Use the te
The sum of the interior angles of a regular pentangon
2. What is the equation for the table below: х y 5 10 6 30 8 8 50
What is the IUPAC name for the compound shown?
ANYONE PLEASE HELP ASAP?!!!!!!!!!
What did most women find life like in the 1950s?
Why does the poet use a similar phrase at the beginning of each stanza.
What is the answer to this division equation? 43 ÷ 8 = ? A. 8 r. 3 B. 5 r. 3 C. 7 D. 6 r. 5
22. Every hour, Jennifer can sew 24 dresses while her mother can sew only 20 dresses. How long will it take them to sew 110 dresses together? (A) 1.5 hours (B)
Find the exact value of expression Sin(100)cos(40)-cos(100)sin(40)