telmajo1261 telmajo1261

11-08-2017
Biology

contestada

How does blood flow through the heart and lungs during fetal circulation?

Respuesta :

11-08-2017

most blood flows across to the left atrium through a shunt called the foramen ovale. then from the left atrium, blood moves down into the lower chamber of the heart. It is then pumped into the first part of the large artery coming from the heart

Answer Link

Otras preguntas

After the resolution to the 1973 oil embargo, what did U.S. officials realize was going to be a necessary development? A. finding other fuel sources B. exportin

What is the impact of war in international trade

what is the Volume, in cubic feet, of a cylinder with a height of 3 feet and a base radius of 2 feet, to the nearest tenths place?

Find 25% out of the 0.45 and round it to the nearest thousandths

2x -3 = 7 pls answer the question

A recipe for 20 rolls requires 5 tablespoons of butter. How many tablespoons of butter I needed for 30 rolls(explain in full)

The sales manager has not set a time for the meeting. Is this a fragment run on, sliced are complete sentence

Which types of objects can contribute to caught-in or caught-between incidents

Dividends are paid out of profits, and: (A) dividends are paid before a firm's taxes are paid. (B) dividend payments must be approved by the firm's board of dir

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2