navishasapp3815 navishasapp3815

11-11-2017
Mathematics

contestada

How to find geometry of an unequal length triangle with angles known?

Respuesta :

roro1231 roro1231

11-11-2017

use the cosine or sin rule, depending on the question.

Ver imagen roro1231

Answer Link

Otras preguntas

What is the central claim that King James makes in his speech?

volume of a cylinders

Line m has a y-intercept of c and a slope of , where p > 0, q > 0, and p ≠ q. What is the slope of a line that is perpendicular to line m?

2. A year on Jupiter is 4,333 days long. A year on Mercury is 88 days long. Why do planets have different length years? a. A year is longer on larger planets b.

21. Water that is sprayed upward from a sprinkler with an initial velocity of 20 m/s can be approximated by the function y=-5x² + 20x, where y is the height of

Describe the following pattern:0;1;1;2;3;5;8;13

6. The probability that the Spartans win a certain game is 50%. A fair coin is used to simulate the team's chances of winning 4 of the next 7 games. A winning g

What would you call 211 for?

please someone help me with this !!

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2