asdjaklskjturil asdjaklskjturil

16-01-2018
Mathematics

contestada

how do you write the expression as an angle sin42cos17-cos42sin17

Respuesta :

16-01-2018

sin(a+b)=sin(a)cos(b)+cos(a)sin(b).
Let a=42 and b=17 so sin(42+17)=sin59.

Answer Link

Otras preguntas

Which of the following statements is true about prairie dogs a. Prairie dogs have a specific call to indicate the intelligence of the predator. b. Prairie dogs

what are the four regions of sub-Saharan africa?

How does access to sunlight affect the biodiversity of a river ecosystem

synonym for~ permeate A. regular B. to spread throughout C. to continue to try D. to open

Which phrase best describes the main function of the stomach? A. contracts to move substances through the body B. provides structure and support C. re

How does the Civil War still affect us today? Please write 10 or more sentences. (goal is to stay in the 4 column)

You have an insurance policy with a $300 premium and a $500 deductible. How much should you expect to pay the insurance company each month for coverage?

Which process helps make meiotic vlcells genetically different and occurs during prophase 1 ,but not during prophase 2

Your mother is worried because she heard that the chicken pox vaccine your baby brother is going to receive is weakened form of the virus that causes the diseas

what does this mean ?standarized test are unnessary becuase they rarely show what we dont already know.